C14H13NO2 — CID 18289
2-amino-2,2-diphenylacetic acid (PubChem CID 18289) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-amino-2,2-diphenylacetic acid.
| Compound Name | 2-amino-2,2-diphenylacetic acid |
|---|---|
| PubChem CID | 18289 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-amino-2,2-diphenylacetic acid |
| SMILES | NC(C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13NO2/c15-14(13(16)17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,15H2,(H,16,17) |
| InChIKey | YBONNYNNFBAKLI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |