2-amino-2-(2,4-difluorophenyl)acetic acid

C8H7F2NO2 — CID 2737050

IUPAC2-amino-2-(2,4-difluorophenyl)acetic acid
SMILESNC(C(=O)O)c1ccc(F)cc1F
InChIInChI=1S/C8H7F2NO2/c9-4-1-2-5(6(10)3-4)7(11)8(12)13/h1-3,7H,11H2,(H,12,13)
InChIKeyCOIWYFIMAXMSKX-UHFFFAOYSA-N
MW187.15 g/mol
LogP1.05
Rot. Bonds2

About 2-amino-2-(2,4-difluorophenyl)acetic acid

2-amino-2-(2,4-difluorophenyl)acetic acid (PubChem CID 2737050) has the molecular formula C8H7F2NO2 and a molecular weight of 187.15 g/mol. Its IUPAC name is 2-amino-2-(2,4-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(2,4-difluorophenyl)acetic acid
PubChem CID2737050
Molecular FormulaC8H7F2NO2
Molecular Weight187.15 g/mol
Exact Mass187.04
IUPAC Name2-amino-2-(2,4-difluorophenyl)acetic acid
SMILESNC(C(=O)O)c1ccc(F)cc1F
InChIInChI=1S/C8H7F2NO2/c9-4-1-2-5(6(10)3-4)7(11)8(12)13/h1-3,7H,11H2,(H,12,13)
InChIKeyCOIWYFIMAXMSKX-UHFFFAOYSA-N
XLogP1.05
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.15
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-amino-2-(2,4-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(2,4-difluorophenyl)acetic acid?
The IUPAC name of 2-amino-2-(2,4-difluorophenyl)acetic acid (CID 2737050) is 2-amino-2-(2,4-difluorophenyl)acetic acid.
What is the SMILES notation for 2-amino-2-(2,4-difluorophenyl)acetic acid?
The canonical SMILES for 2-amino-2-(2,4-difluorophenyl)acetic acid is NC(C(=O)O)c1ccc(F)cc1F.
What is the InChIKey of 2-amino-2-(2,4-difluorophenyl)acetic acid?
The InChIKey is COIWYFIMAXMSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO2/c9-4-1-2-5(6(10)3-4)7(11)8(12)13/h1-3,7H,11H2,(H,12,13).
What are the key properties of 2-amino-2-(2,4-difluorophenyl)acetic acid?
2-amino-2-(2,4-difluorophenyl)acetic acid has a molecular weight of 187.15 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(2,4-difluorophenyl)acetic acid is sourced from PubChem (CID 2737050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).