About cyclohexanamine;2-phenylacetic acid
cyclohexanamine;2-phenylacetic acid (PubChem CID 70192288) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is cyclohexanamine;2-phenylacetic acid.
Molecular Properties
| Compound Name | cyclohexanamine;2-phenylacetic acid |
| PubChem CID | 70192288 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | cyclohexanamine;2-phenylacetic acid |
| SMILES | NC1CCCCC1.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C6H13N/c9-8(10)6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5H,6H2,(H,9,10);6H,1-5,7H2 |
| InChIKey | FXDWCFTTXMDZNK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexanamine;2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;2-phenylacetic acid?
The IUPAC name of cyclohexanamine;2-phenylacetic acid (CID 70192288) is cyclohexanamine;2-phenylacetic acid.
What is the SMILES notation for cyclohexanamine;2-phenylacetic acid?
The canonical SMILES for cyclohexanamine;2-phenylacetic acid is NC1CCCCC1.O=C(O)Cc1ccccc1.
What is the InChIKey of cyclohexanamine;2-phenylacetic acid?
The InChIKey is FXDWCFTTXMDZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C6H13N/c9-8(10)6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5H,6H2,(H,9,10);6H,1-5,7H2.
What are the key properties of cyclohexanamine;2-phenylacetic acid?
cyclohexanamine;2-phenylacetic acid has a molecular weight of 235.33 g/mol, XLogP of 2.59, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;2-phenylacetic acid is sourced from PubChem (CID 70192288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).