C17H22F2N2 — CID 175196603
3-[(1S,5R)-3-(4,4-difluorocyclohexyl)-3-azabicyclo[3.1.0]hexan-1-yl]aniline (PubChem CID 175196603) has the molecular formula C17H22F2N2 and a molecular weight of 292.37 g/mol. Its IUPAC name is 3-[(1S,5R)-3-(4,4-difluorocyclohexyl)-3-azabicyclo[3.1.0]hexan-1-yl]aniline.
| Compound Name | 3-[(1S,5R)-3-(4,4-difluorocyclohexyl)-3-azabicyclo[3.1.0]hexan-1-yl]aniline |
|---|---|
| PubChem CID | 175196603 |
| Molecular Formula | C17H22F2N2 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[(1S,5R)-3-(4,4-difluorocyclohexyl)-3-azabicyclo[3.1.0]hexan-1-yl]aniline |
| SMILES | Nc1cccc([C@]23C[C@H]2CN(C2CCC(F)(F)CC2)C3)c1 |
| InChI | InChI=1S/C17H22F2N2/c18-17(19)6-4-15(5-7-17)21-10-13-9-16(13,11-21)12-2-1-3-14(20)8-12/h1-3,8,13,15H,4-7,9-11,20H2/t13-,16+/m0/s1 |
| InChIKey | HFISIVGGZZWVNJ-XJKSGUPXSA-N |
| XLogP | 3.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|