C33H33NO — CID 95180846
(2S)-2-cyclopentyl-2-phenyl-N-[(1R)-2-phenyl-1-(4-phenylphenyl)ethyl]acetamide (PubChem CID 95180846) has the molecular formula C33H33NO and a molecular weight of 459.63 g/mol. Its IUPAC name is (2S)-2-cyclopentyl-2-phenyl-N-[(1R)-2-phenyl-1-(4-phenylphenyl)ethyl]acetamide.
| Compound Name | (2S)-2-cyclopentyl-2-phenyl-N-[(1R)-2-phenyl-1-(4-phenylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 95180846 |
| Molecular Formula | C33H33NO |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (2S)-2-cyclopentyl-2-phenyl-N-[(1R)-2-phenyl-1-(4-phenylphenyl)ethyl]acetamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)c1ccc(-c2ccccc2)cc1)[C@H](c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C33H33NO/c35-33(32(30-18-10-11-19-30)29-16-8-3-9-17-29)34-31(24-25-12-4-1-5-13-25)28-22-20-27(21-23-28)26-14-6-2-7-15-26/h1-9,12-17,20-23,30-32H,10-11,18-19,24H2,(H,34,35)/t31-,32-/m1/s1 |
| InChIKey | FOYRQNVOORUIOC-ROJLCIKYSA-N |
| XLogP | 7.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |