C16H21F3N2O2 — CID 54007816
1-ethyl-N-[2-methoxy-5-(trifluoromethyl)phenyl]piperidine-3-carboxamide (PubChem CID 54007816) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-ethyl-N-[2-methoxy-5-(trifluoromethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-ethyl-N-[2-methoxy-5-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 54007816 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-ethyl-N-[2-methoxy-5-(trifluoromethyl)phenyl]piperidine-3-carboxamide |
| SMILES | CCN1CCCC(C(=O)Nc2cc(C(F)(F)F)ccc2OC)C1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-3-21-8-4-5-11(10-21)15(22)20-13-9-12(16(17,18)19)6-7-14(13)23-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,20,22) |
| InChIKey | KQDAEYCHSJOZJX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |