C21H34N2O4 — CID 130388233
(3R)-3-amino-4-cyclohexyl-N-(2,5-dimethoxyphenyl)-2-propan-2-yloxybutanamide (PubChem CID 130388233) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-N-(2,5-dimethoxyphenyl)-2-propan-2-yloxybutanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-N-(2,5-dimethoxyphenyl)-2-propan-2-yloxybutanamide |
|---|---|
| PubChem CID | 130388233 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-N-(2,5-dimethoxyphenyl)-2-propan-2-yloxybutanamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(OC(C)C)[C@H](N)CC2CCCCC2)c1 |
| InChI | InChI=1S/C21H34N2O4/c1-14(2)27-20(17(22)12-15-8-6-5-7-9-15)21(24)23-18-13-16(25-3)10-11-19(18)26-4/h10-11,13-15,17,20H,5-9,12,22H2,1-4H3,(H,23,24)/t17-,20?/m1/s1 |
| InChIKey | OLVXYIQLDNWFRM-DIAVIDTQSA-N |
| XLogP | 3.73 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |