C17H23F3N2O3 — CID 95975281
1-[(1R)-1-cyclohexyl-2,2,2-trifluoroethyl]-3-(2,5-dimethoxyphenyl)urea (PubChem CID 95975281) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is 1-[(1R)-1-cyclohexyl-2,2,2-trifluoroethyl]-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-[(1R)-1-cyclohexyl-2,2,2-trifluoroethyl]-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 95975281 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[(1R)-1-cyclohexyl-2,2,2-trifluoroethyl]-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)N[C@H](C2CCCCC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-24-12-8-9-14(25-2)13(10-12)21-16(23)22-15(17(18,19)20)11-6-4-3-5-7-11/h8-11,15H,3-7H2,1-2H3,(H2,21,22,23)/t15-/m1/s1 |
| InChIKey | DHRCKWHUMRREFV-OAHLLOKOSA-N |
| XLogP | 4.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |