C21H34N2O5 — CID 130340204
(3R)-3-amino-4-cyclohexyl-2-ethoxy-N-(3,4,5-trimethoxyphenyl)butanamide (PubChem CID 130340204) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-2-ethoxy-N-(3,4,5-trimethoxyphenyl)butanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-2-ethoxy-N-(3,4,5-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 130340204 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-2-ethoxy-N-(3,4,5-trimethoxyphenyl)butanamide |
| SMILES | CCOC(C(=O)Nc1cc(OC)c(OC)c(OC)c1)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C21H34N2O5/c1-5-28-19(16(22)11-14-9-7-6-8-10-14)21(24)23-15-12-17(25-2)20(27-4)18(13-15)26-3/h12-14,16,19H,5-11,22H2,1-4H3,(H,23,24)/t16-,19?/m1/s1 |
| InChIKey | PVVWAFVQUYDKHL-VTBWFHPJSA-N |
| XLogP | 3.35 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |