C18H27IN2O2 — CID 70641053
(3R)-3-amino-4-cyclohexyl-N-(4-iodo-2-methylphenyl)-2-methoxybutanamide (PubChem CID 70641053) has the molecular formula C18H27IN2O2 and a molecular weight of 430.33 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-N-(4-iodo-2-methylphenyl)-2-methoxybutanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-N-(4-iodo-2-methylphenyl)-2-methoxybutanamide |
|---|---|
| PubChem CID | 70641053 |
| Molecular Formula | C18H27IN2O2 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-N-(4-iodo-2-methylphenyl)-2-methoxybutanamide |
| SMILES | COC(C(=O)Nc1ccc(I)cc1C)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C18H27IN2O2/c1-12-10-14(19)8-9-16(12)21-18(22)17(23-2)15(20)11-13-6-4-3-5-7-13/h8-10,13,15,17H,3-7,11,20H2,1-2H3,(H,21,22)/t15-,17?/m1/s1 |
| InChIKey | AKLCMRRBSXCQSN-LDCVWXEPSA-N |
| XLogP | 3.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|