C11H15IN2O2 — CID 106111632
3-amino-N-(4-iodo-2-methylphenyl)-2-methoxypropanamide (PubChem CID 106111632) has the molecular formula C11H15IN2O2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 3-amino-N-(4-iodo-2-methylphenyl)-2-methoxypropanamide.
| Compound Name | 3-amino-N-(4-iodo-2-methylphenyl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 106111632 |
| Molecular Formula | C11H15IN2O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-amino-N-(4-iodo-2-methylphenyl)-2-methoxypropanamide |
| SMILES | COC(CN)C(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C11H15IN2O2/c1-7-5-8(12)3-4-9(7)14-11(15)10(6-13)16-2/h3-5,10H,6,13H2,1-2H3,(H,14,15) |
| InChIKey | BCCXRZJTICWZAG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|