C17H17FINO2 — CID 43877200
2-(4-fluorophenoxy)-N-(4-iodo-2-methylphenyl)butanamide (PubChem CID 43877200) has the molecular formula C17H17FINO2 and a molecular weight of 413.23 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(4-iodo-2-methylphenyl)butanamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(4-iodo-2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 43877200 |
| Molecular Formula | C17H17FINO2 |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(4-iodo-2-methylphenyl)butanamide |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C17H17FINO2/c1-3-16(22-14-7-4-12(18)5-8-14)17(21)20-15-9-6-13(19)10-11(15)2/h4-10,16H,3H2,1-2H3,(H,20,21) |
| InChIKey | ZAJDLULMEDYRCO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|