C11H15ClIN3O2 — CID 119955707
2-amino-N-(4-iodo-2-methylphenyl)butanediamide;hydrochloride (PubChem CID 119955707) has the molecular formula C11H15ClIN3O2 and a molecular weight of 383.62 g/mol. Its IUPAC name is 2-amino-N-(4-iodo-2-methylphenyl)butanediamide;hydrochloride.
| Compound Name | 2-amino-N-(4-iodo-2-methylphenyl)butanediamide;hydrochloride |
|---|---|
| PubChem CID | 119955707 |
| Molecular Formula | C11H15ClIN3O2 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 2-amino-N-(4-iodo-2-methylphenyl)butanediamide;hydrochloride |
| SMILES | Cc1cc(I)ccc1NC(=O)C(N)CC(N)=O.Cl |
| InChI | InChI=1S/C11H14IN3O2.ClH/c1-6-4-7(12)2-3-9(6)15-11(17)8(13)5-10(14)16;/h2-4,8H,5,13H2,1H3,(H2,14,16)(H,15,17);1H |
| InChIKey | PNYCYGDDAVSEAC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|