C15H23IN2O — CID 107471361
2-(aminomethyl)-N-(4-iodo-2-methylphenyl)-4,4-dimethylpentanamide (PubChem CID 107471361) has the molecular formula C15H23IN2O and a molecular weight of 374.27 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(4-iodo-2-methylphenyl)-4,4-dimethylpentanamide.
| Compound Name | 2-(aminomethyl)-N-(4-iodo-2-methylphenyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 107471361 |
| Molecular Formula | C15H23IN2O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-(aminomethyl)-N-(4-iodo-2-methylphenyl)-4,4-dimethylpentanamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C(CN)CC(C)(C)C |
| InChI | InChI=1S/C15H23IN2O/c1-10-7-12(16)5-6-13(10)18-14(19)11(9-17)8-15(2,3)4/h5-7,11H,8-9,17H2,1-4H3,(H,18,19) |
| InChIKey | OJNBDDUHMDMQMT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|