C17H19IN2O — CID 104983994
(2S)-2-amino-N-(4-iodo-2-methylphenyl)-4-phenylbutanamide (PubChem CID 104983994) has the molecular formula C17H19IN2O and a molecular weight of 394.26 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-iodo-2-methylphenyl)-4-phenylbutanamide.
| Compound Name | (2S)-2-amino-N-(4-iodo-2-methylphenyl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 104983994 |
| Molecular Formula | C17H19IN2O |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (2S)-2-amino-N-(4-iodo-2-methylphenyl)-4-phenylbutanamide |
| SMILES | Cc1cc(I)ccc1NC(=O)[C@@H](N)CCc1ccccc1 |
| InChI | InChI=1S/C17H19IN2O/c1-12-11-14(18)8-10-16(12)20-17(21)15(19)9-7-13-5-3-2-4-6-13/h2-6,8,10-11,15H,7,9,19H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | PXIYPNUOOPYZJX-HNNXBMFYSA-N |
| XLogP | 3.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|