C10H13IN2O2 — CID 106111227
3-amino-N-(2-iodophenyl)-2-methoxypropanamide (PubChem CID 106111227) has the molecular formula C10H13IN2O2 and a molecular weight of 320.13 g/mol. Its IUPAC name is 3-amino-N-(2-iodophenyl)-2-methoxypropanamide.
| Compound Name | 3-amino-N-(2-iodophenyl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 106111227 |
| Molecular Formula | C10H13IN2O2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 3-amino-N-(2-iodophenyl)-2-methoxypropanamide |
| SMILES | COC(CN)C(=O)Nc1ccccc1I |
| InChI | InChI=1S/C10H13IN2O2/c1-15-9(6-12)10(14)13-8-5-3-2-4-7(8)11/h2-5,9H,6,12H2,1H3,(H,13,14) |
| InChIKey | IUEYYCIYGAEPQD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|