C19H30N2O5 — CID 10133507
(3R)-3-amino-4-cyclohexyl-2-hydroxy-N-(2,3,4-trimethoxyphenyl)butanamide (PubChem CID 10133507) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-(2,3,4-trimethoxyphenyl)butanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-(2,3,4-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 10133507 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-(2,3,4-trimethoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)C(O)[C@H](N)CC2CCCCC2)c(OC)c1OC |
| InChI | InChI=1S/C19H30N2O5/c1-24-15-10-9-14(17(25-2)18(15)26-3)21-19(23)16(22)13(20)11-12-7-5-4-6-8-12/h9-10,12-13,16,22H,4-8,11,20H2,1-3H3,(H,21,23)/t13-,16?/m1/s1 |
| InChIKey | HGWVADFFRRDEDE-JBZHPUCOSA-N |
| XLogP | 2.31 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |