C20H31IN2O2 — CID 58534764
(3R)-3-amino-4-cyclohexyl-N-(4-iodo-2-methylphenyl)-2-propan-2-yloxybutanamide (PubChem CID 58534764) has the molecular formula C20H31IN2O2 and a molecular weight of 458.38 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-N-(4-iodo-2-methylphenyl)-2-propan-2-yloxybutanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-N-(4-iodo-2-methylphenyl)-2-propan-2-yloxybutanamide |
|---|---|
| PubChem CID | 58534764 |
| Molecular Formula | C20H31IN2O2 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-N-(4-iodo-2-methylphenyl)-2-propan-2-yloxybutanamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C(OC(C)C)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C20H31IN2O2/c1-13(2)25-19(17(22)12-15-7-5-4-6-8-15)20(24)23-18-10-9-16(21)11-14(18)3/h9-11,13,15,17,19H,4-8,12,22H2,1-3H3,(H,23,24)/t17-,19?/m1/s1 |
| InChIKey | UFNFLIUSJQMLSH-DUSLRRAJSA-N |
| XLogP | 4.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|