C13H20N2O5 — CID 106111011
3-amino-2-methoxy-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 106111011) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-amino-2-methoxy-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 106111011 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-amino-2-methoxy-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(NC(=O)C(CN)OC)cc(OC)c1OC |
| InChI | InChI=1S/C13H20N2O5/c1-17-9-5-8(6-10(18-2)12(9)20-4)15-13(16)11(7-14)19-3/h5-6,11H,7,14H2,1-4H3,(H,15,16) |
| InChIKey | GQZOHMCBUUWAJU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |