C12H18N2O4 — CID 114144862
3-amino-N-(3,4-dimethoxyphenyl)-2-methoxypropanamide (PubChem CID 114144862) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-amino-N-(3,4-dimethoxyphenyl)-2-methoxypropanamide.
| Compound Name | 3-amino-N-(3,4-dimethoxyphenyl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 114144862 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-amino-N-(3,4-dimethoxyphenyl)-2-methoxypropanamide |
| SMILES | COc1ccc(NC(=O)C(CN)OC)cc1OC |
| InChI | InChI=1S/C12H18N2O4/c1-16-9-5-4-8(6-10(9)17-2)14-12(15)11(7-13)18-3/h4-6,11H,7,13H2,1-3H3,(H,14,15) |
| InChIKey | DUOYSZVDPFSFLI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |