C18H28O3 — CID 139373079
5-[(2S)-1-cyclohexylpropan-2-yl]-1,2,3-trimethoxybenzene (PubChem CID 139373079) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 5-[(2S)-1-cyclohexylpropan-2-yl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(2S)-1-cyclohexylpropan-2-yl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 139373079 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 5-[(2S)-1-cyclohexylpropan-2-yl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc([C@@H](C)CC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H28O3/c1-13(10-14-8-6-5-7-9-14)15-11-16(19-2)18(21-4)17(12-15)20-3/h11-14H,5-10H2,1-4H3/t13-/m0/s1 |
| InChIKey | NMMLVZIIAUVRNI-ZDUSSCGKSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |