C21H36NO5P — CID 67741861
cyclohexylmethyl-[3-[1-(3,4,5-trimethoxyphenyl)ethylamino]propyl]phosphinic acid (PubChem CID 67741861) has the molecular formula C21H36NO5P and a molecular weight of 413.50 g/mol. Its IUPAC name is cyclohexylmethyl-[3-[1-(3,4,5-trimethoxyphenyl)ethylamino]propyl]phosphinic acid.
| Compound Name | cyclohexylmethyl-[3-[1-(3,4,5-trimethoxyphenyl)ethylamino]propyl]phosphinic acid |
|---|---|
| PubChem CID | 67741861 |
| Molecular Formula | C21H36NO5P |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | cyclohexylmethyl-[3-[1-(3,4,5-trimethoxyphenyl)ethylamino]propyl]phosphinic acid |
| SMILES | COc1cc(C(C)NCCCP(=O)(O)CC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H36NO5P/c1-16(18-13-19(25-2)21(27-4)20(14-18)26-3)22-11-8-12-28(23,24)15-17-9-6-5-7-10-17/h13-14,16-17,22H,5-12,15H2,1-4H3,(H,23,24) |
| InChIKey | LVTRSRKQZWUSII-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|