C22H28F3N3O3 — CID 145268916
1-cyclohexyl-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea;3-(methoxymethyl)pyridine (PubChem CID 145268916) has the molecular formula C22H28F3N3O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea;3-(methoxymethyl)pyridine.
| Compound Name | 1-cyclohexyl-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea;3-(methoxymethyl)pyridine |
|---|---|
| PubChem CID | 145268916 |
| Molecular Formula | C22H28F3N3O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 1-cyclohexyl-3-[2-methoxy-5-(trifluoromethyl)phenyl]urea;3-(methoxymethyl)pyridine |
| SMILES | COCc1cccnc1.COc1ccc(C(F)(F)F)cc1NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H19F3N2O2.C7H9NO/c1-22-13-8-7-10(15(16,17)18)9-12(13)20-14(21)19-11-5-3-2-4-6-11;1-9-6-7-3-2-4-8-5-7/h7-9,11H,2-6H2,1H3,(H2,19,20,21);2-5H,6H2,1H3 |
| InChIKey | DDGPBFVXZCFFFL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |