C21H25F3N4O4 — CID 145268924
1-cyclohexyl-3-[2-(oxetan-3-yloxy)-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-6-one (PubChem CID 145268924) has the molecular formula C21H25F3N4O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(oxetan-3-yloxy)-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-6-one.
| Compound Name | 1-cyclohexyl-3-[2-(oxetan-3-yloxy)-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145268924 |
| Molecular Formula | C21H25F3N4O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 1-cyclohexyl-3-[2-(oxetan-3-yloxy)-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-6-one |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1OC1COC1)NC1CCCCC1.O=c1ccnc[nH]1 |
| InChI | InChI=1S/C17H21F3N2O3.C4H4N2O/c18-17(19,20)11-6-7-15(25-13-9-24-10-13)14(8-11)22-16(23)21-12-4-2-1-3-5-12;7-4-1-2-5-3-6-4/h6-8,12-13H,1-5,9-10H2,(H2,21,22,23);1-3H,(H,5,6,7) |
| InChIKey | MEZMREGIJDOIPO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |