C17H22F3N3O3 — CID 166211547
1-(1-methyl-6-oxopiperidin-3-yl)-3-[2-propoxy-5-(trifluoromethyl)phenyl]urea (PubChem CID 166211547) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-(1-methyl-6-oxopiperidin-3-yl)-3-[2-propoxy-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1-methyl-6-oxopiperidin-3-yl)-3-[2-propoxy-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 166211547 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-(1-methyl-6-oxopiperidin-3-yl)-3-[2-propoxy-5-(trifluoromethyl)phenyl]urea |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1NC(=O)NC1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C17H22F3N3O3/c1-3-8-26-14-6-4-11(17(18,19)20)9-13(14)22-16(25)21-12-5-7-15(24)23(2)10-12/h4,6,9,12H,3,5,7-8,10H2,1-2H3,(H2,21,22,25) |
| InChIKey | LBACHVMPXBZFSC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |