C21H32F3N3O4S — CID 21198835
3-amino-4-cyclohexyl-2-hydroxy-N-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butyl]butanamide (PubChem CID 21198835) has the molecular formula C21H32F3N3O4S and a molecular weight of 479.57 g/mol. Its IUPAC name is 3-amino-4-cyclohexyl-2-hydroxy-N-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butyl]butanamide.
| Compound Name | 3-amino-4-cyclohexyl-2-hydroxy-N-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butyl]butanamide |
|---|---|
| PubChem CID | 21198835 |
| Molecular Formula | C21H32F3N3O4S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 3-amino-4-cyclohexyl-2-hydroxy-N-[4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butyl]butanamide |
| SMILES | NC(CC1CCCCC1)C(O)C(=O)NCCCCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H32F3N3O4S/c22-21(23,24)16-9-6-10-17(14-16)32(30,31)27-12-5-4-11-26-20(29)19(28)18(25)13-15-7-2-1-3-8-15/h6,9-10,14-15,18-19,27-28H,1-5,7-8,11-13,25H2,(H,26,29) |
| InChIKey | VAGOIXIKSNMGRR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|