C19H28F3N3O3S — CID 56548903
N-[4-(4-methylpiperidin-1-yl)butyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 56548903) has the molecular formula C19H28F3N3O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)butyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)butyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 56548903 |
| Molecular Formula | C19H28F3N3O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)butyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | CC1CCN(CCCCNC(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H28F3N3O3S/c1-15-7-11-25(12-8-15)10-3-2-9-23-18(26)14-24-29(27,28)17-6-4-5-16(13-17)19(20,21)22/h4-6,13,15,24H,2-3,7-12,14H2,1H3,(H,23,26) |
| InChIKey | ULHFVIJTCMNQLA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|