C26H40N4O4 — CID 144669552
N-(diaminomethylidene)-4-methylpentanamide;1-(3,4-dimethoxyphenyl)-N-methylmethanamine;3-phenylpropanal (PubChem CID 144669552) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-methylpentanamide;1-(3,4-dimethoxyphenyl)-N-methylmethanamine;3-phenylpropanal.
| Compound Name | N-(diaminomethylidene)-4-methylpentanamide;1-(3,4-dimethoxyphenyl)-N-methylmethanamine;3-phenylpropanal |
|---|---|
| PubChem CID | 144669552 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | N-(diaminomethylidene)-4-methylpentanamide;1-(3,4-dimethoxyphenyl)-N-methylmethanamine;3-phenylpropanal |
| SMILES | CC(C)CCC(=O)N=C(N)N.CNCc1ccc(OC)c(OC)c1.O=CCCc1ccccc1 |
| InChI | InChI=1S/C10H15NO2.C9H10O.C7H15N3O/c1-11-7-8-4-5-9(12-2)10(6-8)13-3;10-8-4-7-9-5-2-1-3-6-9;1-5(2)3-4-6(11)10-7(8)9/h4-6,11H,7H2,1-3H3;1-3,5-6,8H,4,7H2;5H,3-4H2,1-2H3,(H4,8,9,10,11) |
| InChIKey | UVXXTIHVLAEFKJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|