C22H36N4O5 — CID 144669624
N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide;4-methyl-N-(oxan-4-yl)pentanamide (PubChem CID 144669624) has the molecular formula C22H36N4O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide;4-methyl-N-(oxan-4-yl)pentanamide.
| Compound Name | N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide;4-methyl-N-(oxan-4-yl)pentanamide |
|---|---|
| PubChem CID | 144669624 |
| Molecular Formula | C22H36N4O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide;4-methyl-N-(oxan-4-yl)pentanamide |
| SMILES | CC(C)CCC(=O)NC1CCOCC1.COc1ccc(CC(=O)N=C(N)N)cc1OC |
| InChI | InChI=1S/C11H15N3O3.C11H21NO2/c1-16-8-4-3-7(5-9(8)17-2)6-10(15)14-11(12)13;1-9(2)3-4-11(13)12-10-5-7-14-8-6-10/h3-5H,6H2,1-2H3,(H4,12,13,14,15);9-10H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | IVVLNEBILPPZGH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|