C25H37N7O4 — CID 144669534
N-[[3-[(Z)-C-aminocarbonohydrazonoyl]phenyl]methyl]-4-methylpentanamide;N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 144669534) has the molecular formula C25H37N7O4 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[[3-[(Z)-C-aminocarbonohydrazonoyl]phenyl]methyl]-4-methylpentanamide;N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[[3-[(Z)-C-aminocarbonohydrazonoyl]phenyl]methyl]-4-methylpentanamide;N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 144669534 |
| Molecular Formula | C25H37N7O4 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | N-[[3-[(Z)-C-aminocarbonohydrazonoyl]phenyl]methyl]-4-methylpentanamide;N-(diaminomethylidene)-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | CC(C)CCC(=O)NCc1cccc(/C(N)=N/N)c1.COc1ccc(CC(=O)N=C(N)N)cc1OC |
| InChI | InChI=1S/C14H22N4O.C11H15N3O3/c1-10(2)6-7-13(19)17-9-11-4-3-5-12(8-11)14(15)18-16;1-16-8-4-3-7(5-9(8)17-2)6-10(15)14-11(12)13/h3-5,8,10H,6-7,9,16H2,1-2H3,(H2,15,18)(H,17,19);3-5H,6H2,1-2H3,(H4,12,13,14,15) |
| InChIKey | LCNFXULPONBGJT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 193.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|