C29H41F4N3O5 — CID 159184578
2-cyclohexyl-N-[N'-[(2R)-1-cyclohexyl-5-(4-fluoro-3-methoxyphenyl)-3-oxopentan-2-yl]carbamimidoyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 159184578) has the molecular formula C29H41F4N3O5 and a molecular weight of 587.66 g/mol. Its IUPAC name is 2-cyclohexyl-N-[N'-[(2R)-1-cyclohexyl-5-(4-fluoro-3-methoxyphenyl)-3-oxopentan-2-yl]carbamimidoyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-cyclohexyl-N-[N'-[(2R)-1-cyclohexyl-5-(4-fluoro-3-methoxyphenyl)-3-oxopentan-2-yl]carbamimidoyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159184578 |
| Molecular Formula | C29H41F4N3O5 |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | 2-cyclohexyl-N-[N'-[(2R)-1-cyclohexyl-5-(4-fluoro-3-methoxyphenyl)-3-oxopentan-2-yl]carbamimidoyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(CCC(=O)[C@@H](CC2CCCCC2)/N=C(\N)NC(=O)CC2CCCCC2)ccc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H40FN3O3.C2HF3O2/c1-34-25-17-21(12-14-22(25)28)13-15-24(32)23(16-19-8-4-2-5-9-19)30-27(29)31-26(33)18-20-10-6-3-7-11-20;3-2(4,5)1(6)7/h12,14,17,19-20,23H,2-11,13,15-16,18H2,1H3,(H3,29,30,31,33);(H,6,7)/t23-;/m1./s1 |
| InChIKey | SLLRUOAFHXKPJN-GNAFDRTKSA-N |
| XLogP | 5.71 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|