C29H36FN3O3 — CID 160756455
N-[N'-[(2R)-1-cyclohexyl-5-(4-fluoro-3-methoxyphenyl)-3-oxopentan-2-yl]carbamimidoyl]-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 160756455) has the molecular formula C29H36FN3O3 and a molecular weight of 493.62 g/mol. Its IUPAC name is N-[N'-[(2R)-1-cyclohexyl-5-(4-fluoro-3-methoxyphenyl)-3-oxopentan-2-yl]carbamimidoyl]-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-[N'-[(2R)-1-cyclohexyl-5-(4-fluoro-3-methoxyphenyl)-3-oxopentan-2-yl]carbamimidoyl]-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 160756455 |
| Molecular Formula | C29H36FN3O3 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | N-[N'-[(2R)-1-cyclohexyl-5-(4-fluoro-3-methoxyphenyl)-3-oxopentan-2-yl]carbamimidoyl]-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | COc1cc(CCC(=O)[C@@H](CC2CCCCC2)/N=C(\N)NC(=O)C2Cc3ccccc3C2)ccc1F |
| InChI | InChI=1S/C29H36FN3O3/c1-36-27-16-20(11-13-24(27)30)12-14-26(34)25(15-19-7-3-2-4-8-19)32-29(31)33-28(35)23-17-21-9-5-6-10-22(21)18-23/h5-6,9-11,13,16,19,23,25H,2-4,7-8,12,14-15,17-18H2,1H3,(H3,31,32,33,35)/t25-/m1/s1 |
| InChIKey | RXMNWRLLEYFHJT-RUZDIDTESA-N |
| XLogP | 4.52 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|