C10H12BrF2NO — CID 115262117
N-(bromomethyl)-1-(2,5-difluoro-4-methoxyphenyl)-N-methylmethanamine (PubChem CID 115262117) has the molecular formula C10H12BrF2NO and a molecular weight of 280.11 g/mol. Its IUPAC name is N-(bromomethyl)-1-(2,5-difluoro-4-methoxyphenyl)-N-methylmethanamine.
| Compound Name | N-(bromomethyl)-1-(2,5-difluoro-4-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115262117 |
| Molecular Formula | C10H12BrF2NO |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | N-(bromomethyl)-1-(2,5-difluoro-4-methoxyphenyl)-N-methylmethanamine |
| SMILES | COc1cc(F)c(CN(C)CBr)cc1F |
| InChI | InChI=1S/C10H12BrF2NO/c1-14(6-11)5-7-3-9(13)10(15-2)4-8(7)12/h3-4H,5-6H2,1-2H3 |
| InChIKey | JJHVKIUOUXKODD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|