C10H13F2NOS — CID 115228148
[(2,5-difluoro-4-methoxyphenyl)methyl-methylamino]methanethiol (PubChem CID 115228148) has the molecular formula C10H13F2NOS and a molecular weight of 233.28 g/mol. Its IUPAC name is [(2,5-difluoro-4-methoxyphenyl)methyl-methylamino]methanethiol.
| Compound Name | [(2,5-difluoro-4-methoxyphenyl)methyl-methylamino]methanethiol |
|---|---|
| PubChem CID | 115228148 |
| Molecular Formula | C10H13F2NOS |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | [(2,5-difluoro-4-methoxyphenyl)methyl-methylamino]methanethiol |
| SMILES | COc1cc(F)c(CN(C)CS)cc1F |
| InChI | InChI=1S/C10H13F2NOS/c1-13(6-15)5-7-3-9(12)10(14-2)4-8(7)11/h3-4,15H,5-6H2,1-2H3 |
| InChIKey | BPBJURMKMYPIRY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|