C13H19BrO — CID 106681362
2-(3-bromo-2-methylpropyl)-1-methoxy-3,5-dimethylbenzene (PubChem CID 106681362) has the molecular formula C13H19BrO and a molecular weight of 271.20 g/mol. Its IUPAC name is 2-(3-bromo-2-methylpropyl)-1-methoxy-3,5-dimethylbenzene.
| Compound Name | 2-(3-bromo-2-methylpropyl)-1-methoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 106681362 |
| Molecular Formula | C13H19BrO |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-(3-bromo-2-methylpropyl)-1-methoxy-3,5-dimethylbenzene |
| SMILES | COc1cc(C)cc(C)c1CC(C)CBr |
| InChI | InChI=1S/C13H19BrO/c1-9-5-11(3)12(6-10(2)8-14)13(7-9)15-4/h5,7,10H,6,8H2,1-4H3 |
| InChIKey | QPRQBCBVNSPGBI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|