C9H10F2O2 — CID 117281002
1-[4,5-difluoro-2-(hydroxymethyl)phenyl]ethanol (PubChem CID 117281002) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 1-[4,5-difluoro-2-(hydroxymethyl)phenyl]ethanol.
| Compound Name | 1-[4,5-difluoro-2-(hydroxymethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 117281002 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1-[4,5-difluoro-2-(hydroxymethyl)phenyl]ethanol |
| SMILES | CC(O)c1cc(F)c(F)cc1CO |
| InChI | InChI=1S/C9H10F2O2/c1-5(13)7-3-9(11)8(10)2-6(7)4-12/h2-3,5,12-13H,4H2,1H3 |
| InChIKey | LOJVDSGZNCRIOK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |