C11H17BrO — CID 176929029
(5-bromo-2,4-dimethylphenyl)methanol;ethane (PubChem CID 176929029) has the molecular formula C11H17BrO and a molecular weight of 245.16 g/mol. Its IUPAC name is (5-bromo-2,4-dimethylphenyl)methanol;ethane.
| Compound Name | (5-bromo-2,4-dimethylphenyl)methanol;ethane |
|---|---|
| PubChem CID | 176929029 |
| Molecular Formula | C11H17BrO |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (5-bromo-2,4-dimethylphenyl)methanol;ethane |
| SMILES | CC.Cc1cc(C)c(CO)cc1Br |
| InChI | InChI=1S/C9H11BrO.C2H6/c1-6-3-7(2)9(10)4-8(6)5-11;1-2/h3-4,11H,5H2,1-2H3;1-2H3 |
| InChIKey | GGUUMVOXROBYJC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |