C7H7Br2NO — CID 90154017
(2-amino-4,5-dibromophenyl)methanol (PubChem CID 90154017) has the molecular formula C7H7Br2NO and a molecular weight of 280.95 g/mol. Its IUPAC name is (2-amino-4,5-dibromophenyl)methanol.
| Compound Name | (2-amino-4,5-dibromophenyl)methanol |
|---|---|
| PubChem CID | 90154017 |
| Molecular Formula | C7H7Br2NO |
| Molecular Weight | 280.95 g/mol |
| Exact Mass | 278.89 |
| IUPAC Name | (2-amino-4,5-dibromophenyl)methanol |
| SMILES | Nc1cc(Br)c(Br)cc1CO |
| InChI | InChI=1S/C7H7Br2NO/c8-5-1-4(3-11)7(10)2-6(5)9/h1-2,11H,3,10H2 |
| InChIKey | AGRHBGHAZCTJGN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.95 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|