C9H7F6NO — CID 119022514
[2-amino-4,5-bis(trifluoromethyl)phenyl]methanol (PubChem CID 119022514) has the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. Its IUPAC name is [2-amino-4,5-bis(trifluoromethyl)phenyl]methanol.
| Compound Name | [2-amino-4,5-bis(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 119022514 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | [2-amino-4,5-bis(trifluoromethyl)phenyl]methanol |
| SMILES | Nc1cc(C(F)(F)F)c(C(F)(F)F)cc1CO |
| InChI | InChI=1S/C9H7F6NO/c10-8(11,12)5-1-4(3-17)7(16)2-6(5)9(13,14)15/h1-2,17H,3,16H2 |
| InChIKey | UJJNDGXDWWKRAJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|