C11H12Br2O — CID 14493520
4-(2,5-dibromo-4-methylphenyl)butan-2-one (PubChem CID 14493520) has the molecular formula C11H12Br2O and a molecular weight of 320.02 g/mol. Its IUPAC name is 4-(2,5-dibromo-4-methylphenyl)butan-2-one.
| Compound Name | 4-(2,5-dibromo-4-methylphenyl)butan-2-one |
|---|---|
| PubChem CID | 14493520 |
| Molecular Formula | C11H12Br2O |
| Molecular Weight | 320.02 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 4-(2,5-dibromo-4-methylphenyl)butan-2-one |
| SMILES | CC(=O)CCc1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C11H12Br2O/c1-7-5-11(13)9(6-10(7)12)4-3-8(2)14/h5-6H,3-4H2,1-2H3 |
| InChIKey | GGCGWZBBMPQIOK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.02 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |