C22H25BN2O4 — CID 145054031
[(1R)-2-(4-ethynyl-2-methylphenyl)-1-[[2-(N-propanoylanilino)acetyl]amino]ethyl]boronic acid (PubChem CID 145054031) has the molecular formula C22H25BN2O4 and a molecular weight of 392.26 g/mol. Its IUPAC name is [(1R)-2-(4-ethynyl-2-methylphenyl)-1-[[2-(N-propanoylanilino)acetyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(4-ethynyl-2-methylphenyl)-1-[[2-(N-propanoylanilino)acetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 145054031 |
| Molecular Formula | C22H25BN2O4 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [(1R)-2-(4-ethynyl-2-methylphenyl)-1-[[2-(N-propanoylanilino)acetyl]amino]ethyl]boronic acid |
| SMILES | C#Cc1ccc(C[C@H](NC(=O)CN(C(=O)CC)c2ccccc2)B(O)O)c(C)c1 |
| InChI | InChI=1S/C22H25BN2O4/c1-4-17-11-12-18(16(3)13-17)14-20(23(28)29)24-21(26)15-25(22(27)5-2)19-9-7-6-8-10-19/h1,6-13,20,28-29H,5,14-15H2,2-3H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | LTKLXUPQLQHALE-FQEVSTJZSA-N |
| XLogP | 1.46 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|