C20H27BN2O5S — CID 145054053
[2-(2,4-dimethylphenyl)-1-[[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]amino]ethyl]boronic acid (PubChem CID 145054053) has the molecular formula C20H27BN2O5S and a molecular weight of 418.32 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-1-[[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]amino]ethyl]boronic acid.
| Compound Name | [2-(2,4-dimethylphenyl)-1-[[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 145054053 |
| Molecular Formula | C20H27BN2O5S |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-1-[[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]amino]ethyl]boronic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)NC(Cc2ccc(C)cc2C)B(O)O)cc1 |
| InChI | InChI=1S/C20H27BN2O5S/c1-14-6-9-18(10-7-14)29(27,28)23(4)13-20(24)22-19(21(25)26)12-17-8-5-15(2)11-16(17)3/h5-11,19,25-26H,12-13H2,1-4H3,(H,22,24) |
| InChIKey | KHUUMNZXGCOPFW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|