C22H23BN2O6 — CID 142533457
[(1R)-2-(1-benzofuran-3-yl)-1-[[(1S,6S,7R)-3-cyclopropyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]amino]ethyl]boronic acid (PubChem CID 142533457) has the molecular formula C22H23BN2O6 and a molecular weight of 422.25 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[(1S,6S,7R)-3-cyclopropyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(1S,6S,7R)-3-cyclopropyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 142533457 |
| Molecular Formula | C22H23BN2O6 |
| Molecular Weight | 422.25 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(1S,6S,7R)-3-cyclopropyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carbonyl]amino]ethyl]boronic acid |
| SMILES | O=C(N[C@@H](Cc1coc2ccccc12)B(O)O)[C@H]1C2C(=O)N(C3CC3)C[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C22H23BN2O6/c26-20(24-17(23(28)29)9-12-10-30-15-4-2-1-3-14(12)15)18-16-7-8-22(31-16)11-25(13-5-6-13)21(27)19(18)22/h1-4,7-8,10,13,16-19,28-29H,5-6,9,11H2,(H,24,26)/t16-,17+,18-,19?,22-/m1/s1 |
| InChIKey | VBDCDCCUXDTQCP-FKNWQAAGSA-N |
| XLogP | 0.42 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|