C12H13BrN2O2S — CID 2380414
5-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)furan-2-carboxamide (PubChem CID 2380414) has the molecular formula C12H13BrN2O2S and a molecular weight of 329.22 g/mol. Its IUPAC name is 5-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2380414 |
| Molecular Formula | C12H13BrN2O2S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 5-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)furan-2-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccc(Br)o2)n1 |
| InChI | InChI=1S/C12H13BrN2O2S/c1-12(2,3)8-6-18-11(14-8)15-10(16)7-4-5-9(13)17-7/h4-6H,1-3H3,(H,14,15,16) |
| InChIKey | IPNCFWPSMJZXFO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |