C14H11ClN4O2S2 — CID 164587687
4-[[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide (PubChem CID 164587687) has the molecular formula C14H11ClN4O2S2 and a molecular weight of 366.86 g/mol. Its IUPAC name is 4-[[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 164587687 |
| Molecular Formula | C14H11ClN4O2S2 |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 4-[[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nc(-c3ccnc(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C14H11ClN4O2S2/c15-13-7-9(5-6-17-13)12-8-22-14(19-12)18-10-1-3-11(4-2-10)23(16,20)21/h1-8H,(H,18,19)(H2,16,20,21) |
| InChIKey | LIPYAAFOEWPTGT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|