C12H12ClN5S — CID 145104006
4-(2-chloro-4-pyridinyl)-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104006) has the molecular formula C12H12ClN5S and a molecular weight of 293.78 g/mol. Its IUPAC name is 4-(2-chloro-4-pyridinyl)-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-chloro-4-pyridinyl)-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104006 |
| Molecular Formula | C12H12ClN5S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-(2-chloro-4-pyridinyl)-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | Clc1cc(-c2csc(NC3=NCCCN3)n2)ccn1 |
| InChI | InChI=1S/C12H12ClN5S/c13-10-6-8(2-5-14-10)9-7-19-12(17-9)18-11-15-3-1-4-16-11/h2,5-7H,1,3-4H2,(H2,15,16,17,18) |
| InChIKey | TVYSZUNWRGOZEW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|