C16H15N5OS2 — CID 145104911
2-[4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]phenol (PubChem CID 145104911) has the molecular formula C16H15N5OS2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-[4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]phenol.
| Compound Name | 2-[4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 145104911 |
| Molecular Formula | C16H15N5OS2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc(-c2csc(NC3=NCCCN3)n2)cs1 |
| InChI | InChI=1S/C16H15N5OS2/c22-13-5-2-1-4-10(13)14-19-11(8-23-14)12-9-24-16(20-12)21-15-17-6-3-7-18-15/h1-2,4-5,8-9,22H,3,6-7H2,(H2,17,18,20,21) |
| InChIKey | GYUGSCJLQXFOHJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |