C18H20N6OS3 — CID 145104593
4-[2-(2-cyclopentyloxy-1,3-thiazol-5-yl)-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104593) has the molecular formula C18H20N6OS3 and a molecular weight of 432.60 g/mol. Its IUPAC name is 4-[2-(2-cyclopentyloxy-1,3-thiazol-5-yl)-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(2-cyclopentyloxy-1,3-thiazol-5-yl)-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104593 |
| Molecular Formula | C18H20N6OS3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 4-[2-(2-cyclopentyloxy-1,3-thiazol-5-yl)-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | c1sc(NC2=NCCCN2)nc1-c1csc(-c2cnc(OC3CCCC3)s2)n1 |
| InChI | InChI=1S/C18H20N6OS3/c1-2-5-11(4-1)25-18-21-8-14(28-18)15-22-12(9-26-15)13-10-27-17(23-13)24-16-19-6-3-7-20-16/h8-11H,1-7H2,(H2,19,20,23,24) |
| InChIKey | TWRLJYWOIFCDJR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |