C18H23N7O2S2 — CID 145104942
4-[2-[3-(3-methoxypropoxy)-1-methylpyrazol-5-yl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104942) has the molecular formula C18H23N7O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-[2-[3-(3-methoxypropoxy)-1-methylpyrazol-5-yl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[3-(3-methoxypropoxy)-1-methylpyrazol-5-yl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104942 |
| Molecular Formula | C18H23N7O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 4-[2-[3-(3-methoxypropoxy)-1-methylpyrazol-5-yl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | COCCCOc1cc(-c2nc(-c3csc(NC4=NCCCN4)n3)cs2)n(C)n1 |
| InChI | InChI=1S/C18H23N7O2S2/c1-25-14(9-15(24-25)27-8-4-7-26-2)16-21-12(10-28-16)13-11-29-18(22-13)23-17-19-5-3-6-20-17/h9-11H,3-8H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | BPUIFKYQKSFNKY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|