C20H22N6O3S3 — CID 145104452
4-[2-[4-methyl-6-[(E)-3-methylsulfonylprop-1-enoxy]-3-pyridinyl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104452) has the molecular formula C20H22N6O3S3 and a molecular weight of 490.64 g/mol. Its IUPAC name is 4-[2-[4-methyl-6-[(E)-3-methylsulfonylprop-1-enoxy]-3-pyridinyl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[4-methyl-6-[(E)-3-methylsulfonylprop-1-enoxy]-3-pyridinyl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104452 |
| Molecular Formula | C20H22N6O3S3 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 4-[2-[4-methyl-6-[(E)-3-methylsulfonylprop-1-enoxy]-3-pyridinyl]-1,3-thiazol-4-yl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(O/C=C/CS(C)(=O)=O)ncc1-c1nc(-c2csc(NC3=NCCCN3)n2)cs1 |
| InChI | InChI=1S/C20H22N6O3S3/c1-13-9-17(29-7-4-8-32(2,27)28)23-10-14(13)18-24-15(11-30-18)16-12-31-20(25-16)26-19-21-5-3-6-22-19/h4,7,9-12H,3,5-6,8H2,1-2H3,(H2,21,22,25,26)/b7-4+ |
| InChIKey | GWLQFPPTNPASTA-QPJJXVBHSA-N |
| XLogP | 3.34 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|